About 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile
2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile (PubChem CID 139203706) has the molecular formula C19H20N4O2
and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile |
| PubChem CID | 139203706 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile |
| SMILES | CCN(CC)c1nc(-c2ccc(OC)c(OC)c2)cc(C#N)c1C#N |
| InChI | InChI=1S/C19H20N4O2/c1-5-23(6-2)19-15(12-21)14(11-20)9-16(22-19)13-7-8-17(24-3)18(10-13)25-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | VVFFXVDFUQCMNN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile?
The IUPAC name of 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile (CID 139203706) is 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile.
What is the SMILES notation for 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile?
The canonical SMILES for 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile is CCN(CC)c1nc(-c2ccc(OC)c(OC)c2)cc(C#N)c1C#N.
What is the InChIKey of 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile?
The InChIKey is VVFFXVDFUQCMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-5-23(6-2)19-15(12-21)14(11-20)9-16(22-19)13-7-8-17(24-3)18(10-13)25-4/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile?
2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile has a molecular weight of 336.40 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-6-(3,4-dimethoxyphenyl)pyridine-3,4-dicarbonitrile is sourced from PubChem (CID 139203706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).