C32H46N6O10 — CID 139203717
1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone;methanol (PubChem CID 139203717) has the molecular formula C32H46N6O10 and a molecular weight of 674.75 g/mol. Its IUPAC name is 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone;methanol.
| Compound Name | 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone;methanol |
|---|---|
| PubChem CID | 139203717 |
| Molecular Formula | C32H46N6O10 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 1,10-bis(2-methoxyethyl)-4,7,13,16-tetrakis(prop-2-ynyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone;methanol |
| SMILES | C#CCN1CC(=O)N(CCOC)CC(=O)N(CC#C)CC(=O)N(CC#C)CC(=O)N(CCOC)CC(=O)N(CC#C)CC1=O.CO.CO |
| InChI | InChI=1S/C30H38N6O8.2CH4O/c1-7-11-31-19-25(37)33(13-9-3)21-30(42)36(16-18-44-6)24-28(40)32(12-8-2)20-26(38)34(14-10-4)22-29(41)35(15-17-43-5)23-27(31)39;2*1-2/h1-4H,11-24H2,5-6H3;2*2H,1H3 |
| InChIKey | JWFCPWLAKNVHOH-UHFFFAOYSA-N |
| XLogP | -3.99 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|