C28H22F2N2O2 — CID 139203853
2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]phenol (PubChem CID 139203853) has the molecular formula C28H22F2N2O2 and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]phenol.
| Compound Name | 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139203853 |
| Molecular Formula | C28H22F2N2O2 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]-1,2-diphenylethyl]iminomethyl]phenol |
| SMILES | Oc1c(F)cccc1/C=N/[C@H](c1ccccc1)[C@H](/N=C/c1cccc(F)c1O)c1ccccc1 |
| InChI | InChI=1S/C28H22F2N2O2/c29-23-15-7-13-21(27(23)33)17-31-25(19-9-3-1-4-10-19)26(20-11-5-2-6-12-20)32-18-22-14-8-16-24(30)28(22)34/h1-18,25-26,33-34H/b31-17+,32-18+/t25-,26-/m1/s1 |
| InChIKey | VKYXYMAYHOVDLX-KVTKVSAMSA-N |
| XLogP | 6.40 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|