C13H19NO5 — CID 139203900
(3aS,4S,7R,7aR)-4,7-bis(methoxymethyl)-2-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 139203900) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (3aS,4S,7R,7aR)-4,7-bis(methoxymethyl)-2-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aS,4S,7R,7aR)-4,7-bis(methoxymethyl)-2-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 139203900 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3aS,4S,7R,7aR)-4,7-bis(methoxymethyl)-2-methyl-3a,5,6,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | COC[C@]12CC[C@](COC)(O1)[C@H]1C(=O)N(C)C(=O)[C@H]12 |
| InChI | InChI=1S/C13H19NO5/c1-14-10(15)8-9(11(14)16)13(7-18-3)5-4-12(8,19-13)6-17-2/h8-9H,4-7H2,1-3H3/t8-,9+,12-,13+ |
| InChIKey | BRYGLMGRFGKVBP-KGOITJQVSA-N |
| XLogP | -0.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|