C30H12F4O2S6 — CID 139204020
2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione;bis(3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene) (PubChem CID 139204020) has the molecular formula C30H12F4O2S6 and a molecular weight of 672.82 g/mol. Its IUPAC name is 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione;bis(3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene).
| Compound Name | 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione;bis(3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene) |
|---|---|
| PubChem CID | 139204020 |
| Molecular Formula | C30H12F4O2S6 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 671.91 |
| IUPAC Name | 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione;bis(3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7(11),9,14-hexaene) |
| SMILES | O=C1C(F)=C(F)C(=O)C(F)=C1F.c1cc2c(s1)c1ccsc1c1ccsc21.c1cc2c(s1)c1ccsc1c1ccsc21 |
| InChI | InChI=1S/2C12H6S3.C6F4O2/c2*1-4-13-10-7(1)11-9(2-5-14-11)12-8(10)3-6-15-12;7-1-2(8)6(12)4(10)3(9)5(1)11/h2*1-6H; |
| InChIKey | VFVWQCHZFAVKFT-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|