About bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene
bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene (PubChem CID 139204506) has the molecular formula C30H22Br2I2N4O2
and a molecular weight of 884.15 g/mol. Its IUPAC name is bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene.
Molecular Properties
| Compound Name | bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene |
| PubChem CID | 139204506 |
| Molecular Formula | C30H22Br2I2N4O2 |
| Molecular Weight | 884.15 g/mol |
| Exact Mass | 881.82 |
| IUPAC Name | bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene |
| SMILES | Ic1ccc(I)cc1.Oc1ccc(Br)cc1/C=N/c1cccnc1.Oc1ccc(Br)cc1/C=N/c1cccnc1 |
| InChI | InChI=1S/2C12H9BrN2O.C6H4I2/c2*13-10-3-4-12(16)9(6-10)7-15-11-2-1-5-14-8-11;7-5-1-2-6(8)4-3-5/h2*1-8,16H;1-4H/b2*15-7+; |
| InChIKey | UDKVKXCJMPZHBE-WCMIZXEPSA-N |
| XLogP | 9.50 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 884.15 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene?
The IUPAC name of bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene (CID 139204506) is bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene.
What is the SMILES notation for bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene?
The canonical SMILES for bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene is Ic1ccc(I)cc1.Oc1ccc(Br)cc1/C=N/c1cccnc1.Oc1ccc(Br)cc1/C=N/c1cccnc1.
What is the InChIKey of bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene?
The InChIKey is UDKVKXCJMPZHBE-WCMIZXEPSA-N. The full InChI is InChI=1S/2C12H9BrN2O.C6H4I2/c2*13-10-3-4-12(16)9(6-10)7-15-11-2-1-5-14-8-11;7-5-1-2-6(8)4-3-5/h2*1-8,16H;1-4H/b2*15-7+;.
What are the key properties of bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene?
bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene has a molecular weight of 884.15 g/mol, XLogP of 9.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-bromo-2-(pyridin-3-yliminomethyl)phenol);1,4-diiodobenzene is sourced from PubChem (CID 139204506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).