About 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one
5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one (PubChem CID 139204540) has the molecular formula C8H10O7
and a molecular weight of 218.16 g/mol. Its IUPAC name is 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one |
| PubChem CID | 139204540 |
| Molecular Formula | C8H10O7 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one |
| SMILES | O=C1OCC(OC[C@H]2COC(=O)O2)CO1 |
| InChI | InChI=1S/C8H10O7/c9-7-12-1-5(2-13-7)11-3-6-4-14-8(10)15-6/h5-6H,1-4H2/t6-/m0/s1 |
| InChIKey | IELFAOKMXWCJOS-LURJTMIESA-N |
| XLogP | 0.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one?
The IUPAC name of 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one (CID 139204540) is 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one.
What is the SMILES notation for 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one?
The canonical SMILES for 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one is O=C1OCC(OC[C@H]2COC(=O)O2)CO1.
What is the InChIKey of 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one?
The InChIKey is IELFAOKMXWCJOS-LURJTMIESA-N. The full InChI is InChI=1S/C8H10O7/c9-7-12-1-5(2-13-7)11-3-6-4-14-8(10)15-6/h5-6H,1-4H2/t6-/m0/s1.
What are the key properties of 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one?
5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one has a molecular weight of 218.16 g/mol, XLogP of 0.07, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methoxy]-1,3-dioxan-2-one is sourced from PubChem (CID 139204540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).