About 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one
1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one (PubChem CID 139204590) has the molecular formula C14H15N3O4S
and a molecular weight of 321.36 g/mol. Its IUPAC name is 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one |
| PubChem CID | 139204590 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(=O)[nH]c1.NS(=O)(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C8H8N2O3S.C6H7NO/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7;1-5-2-3-6(8)7-4-5/h1-4H,5H2,(H2,9,11,12);2-4H,1H3,(H,7,8) |
| InChIKey | VHGKWJGSTVKKBR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one?
The IUPAC name of 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one (CID 139204590) is 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one.
What is the SMILES notation for 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one?
The canonical SMILES for 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one is Cc1ccc(=O)[nH]c1.NS(=O)(=O)Cc1noc2ccccc12.
What is the InChIKey of 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one?
The InChIKey is VHGKWJGSTVKKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S.C6H7NO/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7;1-5-2-3-6(8)7-4-5/h1-4H,5H2,(H2,9,11,12);2-4H,1H3,(H,7,8).
What are the key properties of 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one?
1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one has a molecular weight of 321.36 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzoxazol-3-ylmethanesulfonamide;5-methyl-1H-pyridin-2-one is sourced from PubChem (CID 139204590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).