About 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate
1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate (PubChem CID 139204705) has the molecular formula C21H23N3O6S
and a molecular weight of 445.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate |
| PubChem CID | 139204705 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate |
| SMILES | C[NH+]1CCN(c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C19H21N3O2S.C2H2O4/c1-20-11-13-21(14-12-20)19-15-22(18-10-6-5-9-17(18)19)25(23,24)16-7-3-2-4-8-16;3-1(4)2(5)6/h2-10,15H,11-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HWVDNFPCQHVJJV-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate?
The IUPAC name of 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate (CID 139204705) is 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate.
What is the SMILES notation for 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate?
The canonical SMILES for 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate is C[NH+]1CCN(c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)CC1.O=C([O-])C(=O)O.
What is the InChIKey of 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate?
The InChIKey is HWVDNFPCQHVJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2S.C2H2O4/c1-20-11-13-21(14-12-20)19-15-22(18-10-6-5-9-17(18)19)25(23,24)16-7-3-2-4-8-16;3-1(4)2(5)6/h2-10,15H,11-14H2,1H3;(H,3,4)(H,5,6).
What are the key properties of 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate?
1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate has a molecular weight of 445.50 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-(4-methylpiperazin-4-ium-1-yl)indole;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 139204705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).