C11H10O3S — CID 139204725
(1S,3E,5R)-3-(thiophen-2-ylmethylidene)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 139204725) has the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. Its IUPAC name is (1S,3E,5R)-3-(thiophen-2-ylmethylidene)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,3E,5R)-3-(thiophen-2-ylmethylidene)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 139204725 |
| Molecular Formula | C11H10O3S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | (1S,3E,5R)-3-(thiophen-2-ylmethylidene)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1/C(=C/c2cccs2)C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C11H10O3S/c12-10-7(5-9-2-1-3-15-9)4-8-6-13-11(10)14-8/h1-3,5,8,11H,4,6H2/b7-5+/t8-,11+/m0/s1 |
| InChIKey | GGUVJCUZJWCUBN-OKCVOZLHSA-N |
| XLogP | 1.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|