C24H48N4O7 — CID 139204839
(2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide;(2S)-N,N'-dibutyl-2-hydroxybutanediamide (PubChem CID 139204839) has the molecular formula C24H48N4O7 and a molecular weight of 504.67 g/mol. Its IUPAC name is (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide;(2S)-N,N'-dibutyl-2-hydroxybutanediamide.
| Compound Name | (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide;(2S)-N,N'-dibutyl-2-hydroxybutanediamide |
|---|---|
| PubChem CID | 139204839 |
| Molecular Formula | C24H48N4O7 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | (2R,3R)-N,N'-dibutyl-2,3-dihydroxybutanediamide;(2S)-N,N'-dibutyl-2-hydroxybutanediamide |
| SMILES | CCCCNC(=O)C[C@H](O)C(=O)NCCCC.CCCCNC(=O)[C@H](O)[C@@H](O)C(=O)NCCCC |
| InChI | InChI=1S/C12H24N2O4.C12H24N2O3/c1-3-5-7-13-11(17)9(15)10(16)12(18)14-8-6-4-2;1-3-5-7-13-11(16)9-10(15)12(17)14-8-6-4-2/h9-10,15-16H,3-8H2,1-2H3,(H,13,17)(H,14,18);10,15H,3-9H2,1-2H3,(H,13,16)(H,14,17)/t9-,10-;10-/m10/s1 |
| InChIKey | YWJOMEAJFAHZDK-COEXGLNPSA-N |
| XLogP | 0.11 |
| TPSA | 177.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|