C26H25NO8 — CID 139204865
5-O'-ethyl 2-O'-methyl (2'S,4'S,5'S)-2'-(2-methoxy-2-oxoethyl)-1,3-dioxo-4'-phenylspiro[indene-2,3'-pyrrolidine]-2',5'-dicarboxylate (PubChem CID 139204865) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is 5-O'-ethyl 2-O'-methyl (2'S,4'S,5'S)-2'-(2-methoxy-2-oxoethyl)-1,3-dioxo-4'-phenylspiro[indene-2,3'-pyrrolidine]-2',5'-dicarboxylate.
| Compound Name | 5-O'-ethyl 2-O'-methyl (2'S,4'S,5'S)-2'-(2-methoxy-2-oxoethyl)-1,3-dioxo-4'-phenylspiro[indene-2,3'-pyrrolidine]-2',5'-dicarboxylate |
|---|---|
| PubChem CID | 139204865 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 5-O'-ethyl 2-O'-methyl (2'S,4'S,5'S)-2'-(2-methoxy-2-oxoethyl)-1,3-dioxo-4'-phenylspiro[indene-2,3'-pyrrolidine]-2',5'-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@](CC(=O)OC)(C(=O)OC)C2(C(=O)c3ccccc3C2=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H25NO8/c1-4-35-23(31)20-19(15-10-6-5-7-11-15)26(21(29)16-12-8-9-13-17(16)22(26)30)25(27-20,24(32)34-3)14-18(28)33-2/h5-13,19-20,27H,4,14H2,1-3H3/t19-,20+,25-/m1/s1 |
| InChIKey | WXVZAGHICBFAML-OHUGHZGNSA-N |
| XLogP | 1.85 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|