C45H32DyF9N2O9 — CID 139205035
dysprosium(3+);1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-oxobut-2-en-2-olate) (PubChem CID 139205035) has the molecular formula C45H32DyF9N2O9 and a molecular weight of 1078.24 g/mol. Its IUPAC name is dysprosium(3+);1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-oxobut-2-en-2-olate).
| Compound Name | dysprosium(3+);1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-oxobut-2-en-2-olate) |
|---|---|
| PubChem CID | 139205035 |
| Molecular Formula | C45H32DyF9N2O9 |
| Molecular Weight | 1078.24 g/mol |
| Exact Mass | 1079.13 |
| IUPAC Name | dysprosium(3+);1,10-phenanthroline;tris((Z)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-oxobut-2-en-2-olate) |
| SMILES | COc1ccc(C(=O)/C=C(\[O-])C(F)(F)F)cc1.COc1ccc(C(=O)/C=C(\[O-])C(F)(F)F)cc1.COc1ccc(C(=O)/C=C(\[O-])C(F)(F)F)cc1.[Dy+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C11H9F3O3.Dy/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*1-17-8-4-2-7(3-5-8)9(15)6-10(16)11(12,13)14;/h1-8H;3*2-6,16H,1H3;/q;;;;+3/p-3/b;3*10-6-; |
| InChIKey | QAJAAGPWXCFGJB-YRDMVGBYSA-K |
| XLogP | 7.84 |
| TPSA | 173.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.24 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|