About 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate
4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate (PubChem CID 139205062) has the molecular formula C19H23N3O5S2
and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate |
| PubChem CID | 139205062 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate |
| SMILES | CCCSc1ccc2[nH+]c(NC(=O)OC)[nH]c2c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N3O2S.C7H8O3S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16);2-5H,1H3,(H,8,9,10) |
| InChIKey | PFBIXQAWGQSUNV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate?
The IUPAC name of 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate (CID 139205062) is 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate.
What is the SMILES notation for 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate?
The canonical SMILES for 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate is CCCSc1ccc2[nH+]c(NC(=O)OC)[nH]c2c1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate?
The InChIKey is PFBIXQAWGQSUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S.C7H8O3S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16);2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate?
4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate has a molecular weight of 437.54 g/mol, XLogP of 3.56, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;methyl N-(6-propylsulfanyl-1H-benzimidazol-3-ium-2-yl)carbamate is sourced from PubChem (CID 139205062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).