About bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate
bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate (PubChem CID 139205177) has the molecular formula C14H20F2N4O10
and a molecular weight of 442.33 g/mol. Its IUPAC name is bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate.
Molecular Properties
| Compound Name | bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate |
| PubChem CID | 139205177 |
| Molecular Formula | C14H20F2N4O10 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate |
| SMILES | O.O.O=C(O)CCCCC(=O)O.O=c1[nH]cc(F)c(=O)[nH]1.O=c1[nH]cc(F)c(=O)[nH]1 |
| InChI | InChI=1S/C6H10O4.2C4H3FN2O2.2H2O/c7-5(8)3-1-2-4-6(9)10;2*5-2-1-6-4(9)7-3(2)8;;/h1-4H2,(H,7,8)(H,9,10);2*1H,(H2,6,7,8,9);2*1H2 |
| InChIKey | PBEKCSUYAFVKGE-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 269.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate?
The IUPAC name of bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate (CID 139205177) is bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate.
What is the SMILES notation for bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate?
The canonical SMILES for bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate is O.O.O=C(O)CCCCC(=O)O.O=c1[nH]cc(F)c(=O)[nH]1.O=c1[nH]cc(F)c(=O)[nH]1.
What is the InChIKey of bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate?
The InChIKey is PBEKCSUYAFVKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.2C4H3FN2O2.2H2O/c7-5(8)3-1-2-4-6(9)10;2*5-2-1-6-4(9)7-3(2)8;;/h1-4H2,(H,7,8)(H,9,10);2*1H,(H2,6,7,8,9);2*1H2.
What are the key properties of bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate?
bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate has a molecular weight of 442.33 g/mol, XLogP of -2.53, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-fluoro-1H-pyrimidine-2,4-dione);hexanedioic acid;dihydrate is sourced from PubChem (CID 139205177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).