C16H8F4I2N2 — CID 139205206
4-pyridin-4-ylpyridine;1,2,4,5-tetrafluoro-3,6-diiodobenzene (PubChem CID 139205206) has the molecular formula C16H8F4I2N2 and a molecular weight of 558.05 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;1,2,4,5-tetrafluoro-3,6-diiodobenzene.
| Compound Name | 4-pyridin-4-ylpyridine;1,2,4,5-tetrafluoro-3,6-diiodobenzene |
|---|---|
| PubChem CID | 139205206 |
| Molecular Formula | C16H8F4I2N2 |
| Molecular Weight | 558.05 g/mol |
| Exact Mass | 557.87 |
| IUPAC Name | 4-pyridin-4-ylpyridine;1,2,4,5-tetrafluoro-3,6-diiodobenzene |
| SMILES | Fc1c(F)c(I)c(F)c(F)c1I.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C6F4I2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;7-1-2(8)6(12)4(10)3(9)5(1)11/h1-8H; |
| InChIKey | LPQMQKHLEIZQLM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.05 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|