C24H2F10N2S2 — CID 139205838
2-[4,10-bis(2,3,4,5,6-pentafluorophenyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile (PubChem CID 139205838) has the molecular formula C24H2F10N2S2 and a molecular weight of 572.41 g/mol. Its IUPAC name is 2-[4,10-bis(2,3,4,5,6-pentafluorophenyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile.
| Compound Name | 2-[4,10-bis(2,3,4,5,6-pentafluorophenyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139205838 |
| Molecular Formula | C24H2F10N2S2 |
| Molecular Weight | 572.41 g/mol |
| Exact Mass | 571.95 |
| IUPAC Name | 2-[4,10-bis(2,3,4,5,6-pentafluorophenyl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3c(F)c(F)c(F)c(F)c3F)sc2-c2sc(-c3c(F)c(F)c(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C24H2F10N2S2/c25-13-11(14(26)18(30)21(33)17(13)29)8-1-6-10(5(3-35)4-36)7-2-9(38-24(7)23(6)37-8)12-15(27)19(31)22(34)20(32)16(12)28/h1-2H |
| InChIKey | FFNRMAVLLBWUSZ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.41 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|