About platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone)
platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) (PubChem CID 139205859) has the molecular formula C20H14N4O2Pt
and a molecular weight of 537.44 g/mol. Its IUPAC name is platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone).
Molecular Properties
| Compound Name | platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) |
| PubChem CID | 139205859 |
| Molecular Formula | C20H14N4O2Pt |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) |
| SMILES | O=C(c1ccccn1)c1ccc[n-]1.O=C(c1ccccn1)c1ccc[n-]1.[Pt+2] |
| InChI | InChI=1S/2C10H8N2O.Pt/c2*13-10(9-5-3-7-12-9)8-4-1-2-6-11-8;/h2*1-7H,(H,12,13);/q;;+2/p-2 |
| InChIKey | JTEJGAWMJLIAMX-UHFFFAOYSA-L |
| XLogP | 2.54 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone)?
The IUPAC name of platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) (CID 139205859) is platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone).
What is the SMILES notation for platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone)?
The canonical SMILES for platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) is O=C(c1ccccn1)c1ccc[n-]1.O=C(c1ccccn1)c1ccc[n-]1.[Pt+2].
What is the InChIKey of platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone)?
The InChIKey is JTEJGAWMJLIAMX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H8N2O.Pt/c2*13-10(9-5-3-7-12-9)8-4-1-2-6-11-8;/h2*1-7H,(H,12,13);/q;;+2/p-2.
What are the key properties of platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone)?
platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) has a molecular weight of 537.44 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum(2+);bis(pyridin-2-yl(pyrrol-1-id-2-yl)methanone) is sourced from PubChem (CID 139205859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).