C13H16N2O6 — CID 139205973
diethyl (1R,2R,6S,8S)-3,11-dioxa-4,10-diazatricyclo[6.3.0.02,6]undeca-4,9-diene-5,9-dicarboxylate (PubChem CID 139205973) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is diethyl (1R,2R,6S,8S)-3,11-dioxa-4,10-diazatricyclo[6.3.0.02,6]undeca-4,9-diene-5,9-dicarboxylate.
| Compound Name | diethyl (1R,2R,6S,8S)-3,11-dioxa-4,10-diazatricyclo[6.3.0.02,6]undeca-4,9-diene-5,9-dicarboxylate |
|---|---|
| PubChem CID | 139205973 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | diethyl (1R,2R,6S,8S)-3,11-dioxa-4,10-diazatricyclo[6.3.0.02,6]undeca-4,9-diene-5,9-dicarboxylate |
| SMILES | CCOC(=O)C1=NO[C@H]2[C@@H]3ON=C(C(=O)OCC)[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C13H16N2O6/c1-3-18-12(16)8-6-5-7-9(13(17)19-4-2)15-21-11(7)10(6)20-14-8/h6-7,10-11H,3-5H2,1-2H3/t6-,7-,10+,11+/m0/s1 |
| InChIKey | OAPMIGKWNFHUMK-JRPBRRGXSA-N |
| XLogP | 0.26 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |