C21H29NO — CID 139206534
(3aS,4S,5R,7aS)-5-pentyl-N-phenyl-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxamide (PubChem CID 139206534) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (3aS,4S,5R,7aS)-5-pentyl-N-phenyl-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxamide.
| Compound Name | (3aS,4S,5R,7aS)-5-pentyl-N-phenyl-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxamide |
|---|---|
| PubChem CID | 139206534 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (3aS,4S,5R,7aS)-5-pentyl-N-phenyl-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxamide |
| SMILES | CCCCC[C@@H]1C=C[C@@H]2CCC[C@@H]2[C@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-2-3-5-9-17-15-14-16-10-8-13-19(16)20(17)21(23)22-18-11-6-4-7-12-18/h4,6-7,11-12,14-17,19-20H,2-3,5,8-10,13H2,1H3,(H,22,23)/t16-,17+,19-,20-/m0/s1 |
| InChIKey | IENRSPNKQJWIMO-HNJRGHQBSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|