C38H50N2O2 — CID 139206844
2-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]phenol;2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]phenol (PubChem CID 139206844) has the molecular formula C38H50N2O2 and a molecular weight of 566.83 g/mol. Its IUPAC name is 2-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]phenol;2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]phenol.
| Compound Name | 2-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]phenol;2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139206844 |
| Molecular Formula | C38H50N2O2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.39 |
| IUPAC Name | 2-[[(1R)-1-(1-adamantyl)ethyl]iminomethyl]phenol;2-[[(1S)-1-(1-adamantyl)ethyl]iminomethyl]phenol |
| SMILES | C[C@@H](/N=C/c1ccccc1O)C12CC3CC(CC(C3)C1)C2.C[C@H](/N=C/c1ccccc1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/2C19H25NO/c2*1-13(20-12-17-4-2-3-5-18(17)21)19-9-14-6-15(10-19)8-16(7-14)11-19/h2*2-5,12-16,21H,6-11H2,1H3/b2*20-12+/t2*13-,14?,15?,16?,19?/m10/s1 |
| InChIKey | XQIIYGLJQNHIKD-KURUAYIBSA-N |
| XLogP | 8.83 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|