C35H22BF15N2 — CID 139206864
[2-[2,6-di(propan-2-yl)anilino]pyridin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139206864) has the molecular formula C35H22BF15N2 and a molecular weight of 766.36 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]pyridin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]pyridin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139206864 |
| Molecular Formula | C35H22BF15N2 |
| Molecular Weight | 766.36 g/mol |
| Exact Mass | 766.16 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]pyridin-1-ium-1-yl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1cccc[n+]1[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C35H22BF15N2/c1-12(2)14-8-7-9-15(13(3)4)35(14)52-16-10-5-6-11-53(16)36(17-20(37)26(43)32(49)27(44)21(17)38,18-22(39)28(45)33(50)29(46)23(18)40)19-24(41)30(47)34(51)31(48)25(19)42/h5-13,52H,1-4H3 |
| InChIKey | IIPJDRHLVJBJGW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.36 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|