C17H11NO4 — CID 139207000
2-[(3-oxo-1H-2-benzofuran-5-yl)methyl]isoindole-1,3-dione (PubChem CID 139207000) has the molecular formula C17H11NO4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-[(3-oxo-1H-2-benzofuran-5-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-oxo-1H-2-benzofuran-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139207000 |
| Molecular Formula | C17H11NO4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[(3-oxo-1H-2-benzofuran-5-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1OCc2ccc(CN3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C17H11NO4/c19-15-12-3-1-2-4-13(12)16(20)18(15)8-10-5-6-11-9-22-17(21)14(11)7-10/h1-7H,8-9H2 |
| InChIKey | XMRJZGCOBYUJCR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|