About bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate
bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate (PubChem CID 139207315) has the molecular formula C24H24N2O12
and a molecular weight of 532.46 g/mol. Its IUPAC name is bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate.
Molecular Properties
| Compound Name | bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate |
| PubChem CID | 139207315 |
| Molecular Formula | C24H24N2O12 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate |
| SMILES | O.O.O=C(O)c1cc(O)c([O-])c(O)c1.O=C(O)c1cc(O)c([O-])c(O)c1.c1cc(-c2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C10H8N2.2C7H6O5.2H2O/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-8H;2*1-2,8-10H,(H,11,12);2*1H2 |
| InChIKey | YBMCYJPLXMAIAI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 292.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate?
The IUPAC name of bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate (CID 139207315) is bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate.
What is the SMILES notation for bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate?
The canonical SMILES for bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate is O.O.O=C(O)c1cc(O)c([O-])c(O)c1.O=C(O)c1cc(O)c([O-])c(O)c1.c1cc(-c2cc[nH+]cc2)cc[nH+]1.
What is the InChIKey of bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate?
The InChIKey is YBMCYJPLXMAIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C7H6O5.2H2O/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-8H;2*1-2,8-10H,(H,11,12);2*1H2.
What are the key properties of bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate?
bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate has a molecular weight of 532.46 g/mol, XLogP of -0.93, 3 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-carboxy-2,6-dihydroxyphenolate);4-pyridin-1-ium-4-ylpyridin-1-ium;dihydrate is sourced from PubChem (CID 139207315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).