About 2H-indeno[1,2-b]furan
2H-indeno[1,2-b]furan (PubChem CID 139207808) has the molecular formula C11H8O
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2H-indeno[1,2-b]furan.
Molecular Properties
| Compound Name | 2H-indeno[1,2-b]furan |
| PubChem CID | 139207808 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2H-indeno[1,2-b]furan |
| SMILES | C1=C2C=c3ccccc3=C2OC1 |
| InChI | InChI=1S/C11H8O/c1-2-4-10-8(3-1)7-9-5-6-12-11(9)10/h1-5,7H,6H2 |
| InChIKey | KZDSOVDPRYAJPN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-indeno[1,2-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-indeno[1,2-b]furan?
The IUPAC name of 2H-indeno[1,2-b]furan (CID 139207808) is 2H-indeno[1,2-b]furan.
What is the SMILES notation for 2H-indeno[1,2-b]furan?
The canonical SMILES for 2H-indeno[1,2-b]furan is C1=C2C=c3ccccc3=C2OC1.
What is the InChIKey of 2H-indeno[1,2-b]furan?
The InChIKey is KZDSOVDPRYAJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O/c1-2-4-10-8(3-1)7-9-5-6-12-11(9)10/h1-5,7H,6H2.
What are the key properties of 2H-indeno[1,2-b]furan?
2H-indeno[1,2-b]furan has a molecular weight of 156.18 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-indeno[1,2-b]furan is sourced from PubChem (CID 139207808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).