About indeno[1,2-b]pyrrole-3-carboxamide
indeno[1,2-b]pyrrole-3-carboxamide (PubChem CID 139207819) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is indeno[1,2-b]pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | indeno[1,2-b]pyrrole-3-carboxamide |
| PubChem CID | 139207819 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | indeno[1,2-b]pyrrole-3-carboxamide |
| SMILES | NC(=O)C1=CN=C2C1=Cc1ccccc12 |
| InChI | InChI=1S/C12H8N2O/c13-12(15)10-6-14-11-8-4-2-1-3-7(8)5-9(10)11/h1-6H,(H2,13,15) |
| InChIKey | LNRBQDQMPLNKBG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indeno[1,2-b]pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[1,2-b]pyrrole-3-carboxamide?
The IUPAC name of indeno[1,2-b]pyrrole-3-carboxamide (CID 139207819) is indeno[1,2-b]pyrrole-3-carboxamide.
What is the SMILES notation for indeno[1,2-b]pyrrole-3-carboxamide?
The canonical SMILES for indeno[1,2-b]pyrrole-3-carboxamide is NC(=O)C1=CN=C2C1=Cc1ccccc12.
What is the InChIKey of indeno[1,2-b]pyrrole-3-carboxamide?
The InChIKey is LNRBQDQMPLNKBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c13-12(15)10-6-14-11-8-4-2-1-3-7(8)5-9(10)11/h1-6H,(H2,13,15).
What are the key properties of indeno[1,2-b]pyrrole-3-carboxamide?
indeno[1,2-b]pyrrole-3-carboxamide has a molecular weight of 196.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[1,2-b]pyrrole-3-carboxamide is sourced from PubChem (CID 139207819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).