About 1,4-dioctylcyclohexa-2,4-dien-1-amine
1,4-dioctylcyclohexa-2,4-dien-1-amine (PubChem CID 139207875) has the molecular formula C22H41N
and a molecular weight of 319.58 g/mol. Its IUPAC name is 1,4-dioctylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1,4-dioctylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 139207875 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | 1,4-dioctylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCCCCCCC1=CCC(N)(CCCCCCCC)C=C1 |
| InChI | InChI=1S/C22H41N/c1-3-5-7-9-11-13-15-21-16-19-22(23,20-17-21)18-14-12-10-8-6-4-2/h16-17,19H,3-15,18,20,23H2,1-2H3 |
| InChIKey | AAKKZDBDOJWNQA-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioctylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioctylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 1,4-dioctylcyclohexa-2,4-dien-1-amine (CID 139207875) is 1,4-dioctylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1,4-dioctylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1,4-dioctylcyclohexa-2,4-dien-1-amine is CCCCCCCCC1=CCC(N)(CCCCCCCC)C=C1.
What is the InChIKey of 1,4-dioctylcyclohexa-2,4-dien-1-amine?
The InChIKey is AAKKZDBDOJWNQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41N/c1-3-5-7-9-11-13-15-21-16-19-22(23,20-17-21)18-14-12-10-8-6-4-2/h16-17,19H,3-15,18,20,23H2,1-2H3.
What are the key properties of 1,4-dioctylcyclohexa-2,4-dien-1-amine?
1,4-dioctylcyclohexa-2,4-dien-1-amine has a molecular weight of 319.58 g/mol, XLogP of 7.07, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioctylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 139207875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).