About 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate
2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate (PubChem CID 139207911) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate |
| PubChem CID | 139207911 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2[nH+]c(-c3ccccc3OCC(=O)[O-])[nH]c2c1 |
| InChI | InChI=1S/C23H28N2O3/c1-22(2,3)14-11-16(23(4,5)6)20-17(12-14)24-21(25-20)15-9-7-8-10-18(15)28-13-19(26)27/h7-12H,13H2,1-6H3,(H,24,25)(H,26,27) |
| InChIKey | BHLFCCMWBSBKOM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate?
The IUPAC name of 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate (CID 139207911) is 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate.
What is the SMILES notation for 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate?
The canonical SMILES for 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate is CC(C)(C)c1cc(C(C)(C)C)c2[nH+]c(-c3ccccc3OCC(=O)[O-])[nH]c2c1.
What is the InChIKey of 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate?
The InChIKey is BHLFCCMWBSBKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c1-22(2,3)14-11-16(23(4,5)6)20-17(12-14)24-21(25-20)15-9-7-8-10-18(15)28-13-19(26)27/h7-12H,13H2,1-6H3,(H,24,25)(H,26,27).
What are the key properties of 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate?
2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate has a molecular weight of 380.49 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,6-ditert-butyl-1H-benzimidazol-3-ium-2-yl)phenoxy]acetate is sourced from PubChem (CID 139207911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).