C27H25F2N7O4 — CID 139208060
methyl N-[(11E)-14-[(4,6-difluoro-1-methylindazole-5-carbonyl)amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate (PubChem CID 139208060) has the molecular formula C27H25F2N7O4 and a molecular weight of 549.54 g/mol. Its IUPAC name is methyl N-[(11E)-14-[(4,6-difluoro-1-methylindazole-5-carbonyl)amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[(11E)-14-[(4,6-difluoro-1-methylindazole-5-carbonyl)amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 139208060 |
| Molecular Formula | C27H25F2N7O4 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | methyl N-[(11E)-14-[(4,6-difluoro-1-methylindazole-5-carbonyl)amino]-10-methyl-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,11,15-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C(C)/C=C\CC(NC(=O)c1c(F)cc3c(cnn3C)c1F)c1ncc-2[nH]1 |
| InChI | InChI=1S/C27H25F2N7O4/c1-13-5-4-6-18(34-26(38)22-17(28)10-21-16(23(22)29)11-31-36(21)2)24-30-12-20(33-24)15-8-7-14(32-27(39)40-3)9-19(15)35-25(13)37/h4-5,7-13,18H,6H2,1-3H3,(H,30,33)(H,32,39)(H,34,38)(H,35,37)/b5-4- |
| InChIKey | AHYJISJHKIBOPY-PLNGDYQASA-N |
| XLogP | 4.43 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|