About US10208019, Example 1A-15
US10208019, Example 1A-15 (PubChem CID 139208502) has the molecular formula C29H31ClFN5O5
and a molecular weight of 584.00 g/mol. Its IUPAC name is 2-[[(3R)-4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-3-(hydroxymethyl)piperazin-1-yl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | US10208019, Example 1A-15 |
| PubChem CID | 139208502 |
| Molecular Formula | C29H31ClFN5O5 |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 2-[[(3R)-4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-3-(hydroxymethyl)piperazin-1-yl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| SMILES | COCCN1C2=C(C=CC(=C2)C(=O)O)N=C1CN3CCN([C@H](C3)CO)C4=NC(=CC=C4)OCC5=C(C=C(C=C5)Cl)F |
| InChI | InChI=1S/C29H31ClFN5O5/c1-40-12-11-36-25-13-19(29(38)39)6-8-24(25)32-27(36)16-34-9-10-35(22(15-34)17-37)26-3-2-4-28(33-26)41-18-20-5-7-21(30)14-23(20)31/h2-8,13-14,22,37H,9-12,15-18H2,1H3,(H,38,39)/t22-/m1/s1 |
| InChIKey | HYFPLHLYAZTRSX-JOCHJYFZSA-N |
| XLogP | 1.10 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | 849 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US10208019, Example 1A-15 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10208019, Example 1A-15?
The IUPAC name of US10208019, Example 1A-15 (CID 139208502) is 2-[[(3R)-4-[6-[(4-chloro-2-fluorophenyl)methoxy]-2-pyridinyl]-3-(hydroxymethyl)piperazin-1-yl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
What is the SMILES notation for US10208019, Example 1A-15?
The canonical SMILES for US10208019, Example 1A-15 is COCCN1C2=C(C=CC(=C2)C(=O)O)N=C1CN3CCN([C@H](C3)CO)C4=NC(=CC=C4)OCC5=C(C=C(C=C5)Cl)F.
What is the InChIKey of US10208019, Example 1A-15?
The InChIKey is HYFPLHLYAZTRSX-JOCHJYFZSA-N. The full InChI is InChI=1S/C29H31ClFN5O5/c1-40-12-11-36-25-13-19(29(38)39)6-8-24(25)32-27(36)16-34-9-10-35(22(15-34)17-37)26-3-2-4-28(33-26)41-18-20-5-7-21(30)14-23(20)31/h2-8,13-14,22,37H,9-12,15-18H2,1H3,(H,38,39)/t22-/m1/s1.
What are the key properties of US10208019, Example 1A-15?
US10208019, Example 1A-15 has a molecular weight of 584.00 g/mol, XLogP of 1.10, 11 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US10208019, Example 1A-15 is sourced from PubChem (CID 139208502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).