About US10208019, Example 1A-17
US10208019, Example 1A-17 (PubChem CID 139208503) has the molecular formula C31H30F2N6O3
and a molecular weight of 572.60 g/mol. Its IUPAC name is 2-[[4-[6-[(2,4-difluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]methyl]-3-[(3-methylimidazol-4-yl)methyl]benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | US10208019, Example 1A-17 |
| PubChem CID | 139208503 |
| Molecular Formula | C31H30F2N6O3 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 2-[[4-[6-[(2,4-difluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]methyl]-3-[(3-methylimidazol-4-yl)methyl]benzimidazole-5-carboxylic acid |
| SMILES | CN1C=NC=C1CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCC(CC4)C5=NC(=CC=C5)OCC6=C(C=C(C=C6)F)F |
| InChI | InChI=1S/C31H30F2N6O3/c1-37-19-34-15-24(37)16-39-28-13-21(31(40)41)6-8-27(28)35-29(39)17-38-11-9-20(10-12-38)26-3-2-4-30(36-26)42-18-22-5-7-23(32)14-25(22)33/h2-8,13-15,19-20H,9-12,16-18H2,1H3,(H,40,41) |
| InChIKey | IONISRGPWNLVRC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | 897 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10208019, Example 1A-17 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10208019, Example 1A-17?
The IUPAC name of US10208019, Example 1A-17 (CID 139208503) is 2-[[4-[6-[(2,4-difluorophenyl)methoxy]-2-pyridinyl]piperidin-1-yl]methyl]-3-[(3-methylimidazol-4-yl)methyl]benzimidazole-5-carboxylic acid.
What is the SMILES notation for US10208019, Example 1A-17?
The canonical SMILES for US10208019, Example 1A-17 is CN1C=NC=C1CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCC(CC4)C5=NC(=CC=C5)OCC6=C(C=C(C=C6)F)F.
What is the InChIKey of US10208019, Example 1A-17?
The InChIKey is IONISRGPWNLVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30F2N6O3/c1-37-19-34-15-24(37)16-39-28-13-21(31(40)41)6-8-27(28)35-29(39)17-38-11-9-20(10-12-38)26-3-2-4-30(36-26)42-18-22-5-7-23(32)14-25(22)33/h2-8,13-15,19-20H,9-12,16-18H2,1H3,(H,40,41).
What are the key properties of US10208019, Example 1A-17?
US10208019, Example 1A-17 has a molecular weight of 572.60 g/mol, XLogP of 1.50, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10208019, Example 1A-17 is sourced from PubChem (CID 139208503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).