C18H20N6O2 — CID 139208694
N-[1-[3-(5-oxo-1,2,4-triazolidin-3-yl)isoquinolin-1-yl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 139208694) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[1-[3-(5-oxo-1,2,4-triazolidin-3-yl)isoquinolin-1-yl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[3-(5-oxo-1,2,4-triazolidin-3-yl)isoquinolin-1-yl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139208694 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[1-[3-(5-oxo-1,2,4-triazolidin-3-yl)isoquinolin-1-yl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(c2nc(C3NNC(=O)N3)cc3ccccc23)C1 |
| InChI | InChI=1S/C18H20N6O2/c1-2-15(25)19-12-7-8-24(10-12)17-13-6-4-3-5-11(13)9-14(20-17)16-21-18(26)23-22-16/h2-6,9,12,16,22H,1,7-8,10H2,(H,19,25)(H2,21,23,26) |
| InChIKey | RDAUVLJFXVQEQM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|