C18H20N6O2 — CID 139208698
5-[1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one (PubChem CID 139208698) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-[1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-[1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 139208698 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 5-[1-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
| SMILES | C=CC(=O)N1CC[C@H](Nc2nc(C3NNC(=O)N3)cc3ccccc23)C1 |
| InChI | InChI=1S/C18H20N6O2/c1-2-15(25)24-8-7-12(10-24)19-16-13-6-4-3-5-11(13)9-14(20-16)17-21-18(26)23-22-17/h2-6,9,12,17,22H,1,7-8,10H2,(H,19,20)(H2,21,23,26)/t12-,17?/m0/s1 |
| InChIKey | XFGPZKICEZNJQR-WHUIICBVSA-N |
| XLogP | 1.25 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|