C19H22N6O2 — CID 139208700
5-[1-[[(3S)-1-(2-methylprop-2-enoyl)pyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one (PubChem CID 139208700) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 5-[1-[[(3S)-1-(2-methylprop-2-enoyl)pyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-[1-[[(3S)-1-(2-methylprop-2-enoyl)pyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 139208700 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 5-[1-[[(3S)-1-(2-methylprop-2-enoyl)pyrrolidin-3-yl]amino]isoquinolin-3-yl]-1,2,4-triazolidin-3-one |
| SMILES | C=C(C)C(=O)N1CC[C@H](Nc2nc(C3NNC(=O)N3)cc3ccccc23)C1 |
| InChI | InChI=1S/C19H22N6O2/c1-11(2)18(26)25-8-7-13(10-25)20-16-14-6-4-3-5-12(14)9-15(21-16)17-22-19(27)24-23-17/h3-6,9,13,17,23H,1,7-8,10H2,2H3,(H,20,21)(H2,22,24,27)/t13-,17?/m0/s1 |
| InChIKey | DZZBILFXXHCMMJ-CWQZNGJJSA-N |
| XLogP | 1.64 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|