C17H19N7O2 — CID 139208707
5-[8-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,7-naphthyridin-6-yl]-1,2,4-triazolidin-3-one (PubChem CID 139208707) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 5-[8-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,7-naphthyridin-6-yl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-[8-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,7-naphthyridin-6-yl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 139208707 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[8-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]amino]-1,7-naphthyridin-6-yl]-1,2,4-triazolidin-3-one |
| SMILES | C=CC(=O)N1CC[C@H](Nc2nc(C3NNC(=O)N3)cc3cccnc23)C1 |
| InChI | InChI=1S/C17H19N7O2/c1-2-13(25)24-7-5-11(9-24)19-16-14-10(4-3-6-18-14)8-12(20-16)15-21-17(26)23-22-15/h2-4,6,8,11,15,22H,1,5,7,9H2,(H,19,20)(H2,21,23,26)/t11-,15?/m0/s1 |
| InChIKey | FDHUJLGPJOKPPZ-VPHXOMNUSA-N |
| XLogP | 0.64 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|