C39H34N10O4 — CID 139208899
N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-2-cyano-3',6'-bis(dimethylamino)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide (PubChem CID 139208899) has the molecular formula C39H34N10O4 and a molecular weight of 706.77 g/mol. Its IUPAC name is N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-2-cyano-3',6'-bis(dimethylamino)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-2-cyano-3',6'-bis(dimethylamino)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 139208899 |
| Molecular Formula | C39H34N10O4 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.28 |
| IUPAC Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-2-cyano-3',6'-bis(dimethylamino)-1-oxospiro[isoindole-3,9'-xanthene]-5-carboxamide |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21c2cc(C(=O)NCc3ccc(COc4nc(N)nc5nc[nH]c45)cc3)ccc2C(=O)N1C#N |
| InChI | InChI=1S/C39H34N10O4/c1-47(2)25-10-13-28-31(16-25)53-32-17-26(48(3)4)11-14-29(32)39(28)30-15-24(9-12-27(30)37(51)49(39)20-40)35(50)42-18-22-5-7-23(8-6-22)19-52-36-33-34(44-21-43-33)45-38(41)46-36/h5-17,21H,18-19H2,1-4H3,(H,42,50)(H3,41,43,44,45,46) |
| InChIKey | RFOHJHMTAIZTHI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|