About 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile
4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile (PubChem CID 139210665) has the molecular formula C12H10N2O3
and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile |
| PubChem CID | 139210665 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile |
| SMILES | N#CC1C(=O)NC(=O)CC1c1ccc(O)cc1 |
| InChI | InChI=1S/C12H10N2O3/c13-6-10-9(5-11(16)14-12(10)17)7-1-3-8(15)4-2-7/h1-4,9-10,15H,5H2,(H,14,16,17) |
| InChIKey | GLNWFCJJYIJFFQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile?
The IUPAC name of 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile (CID 139210665) is 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile.
What is the SMILES notation for 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile?
The canonical SMILES for 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile is N#CC1C(=O)NC(=O)CC1c1ccc(O)cc1.
What is the InChIKey of 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile?
The InChIKey is GLNWFCJJYIJFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c13-6-10-9(5-11(16)14-12(10)17)7-1-3-8(15)4-2-7/h1-4,9-10,15H,5H2,(H,14,16,17).
What are the key properties of 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile?
4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile has a molecular weight of 230.22 g/mol, XLogP of 0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)-2,6-dioxopiperidine-3-carbonitrile is sourced from PubChem (CID 139210665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).