C14H20O7 — CID 139210720
methyl (1R,2R,6S,7R,8R,9R)-9-(2-methoxy-2-oxoethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 139210720) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is methyl (1R,2R,6S,7R,8R,9R)-9-(2-methoxy-2-oxoethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | methyl (1R,2R,6S,7R,8R,9R)-9-(2-methoxy-2-oxoethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 139210720 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl (1R,2R,6S,7R,8R,9R)-9-(2-methoxy-2-oxoethyl)-4,4-dimethyl-3,5,10-trioxatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COC(=O)C[C@H]1[C@H]2O[C@@H]([C@@H]3OC(C)(C)O[C@@H]32)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C14H20O7/c1-14(2)20-11-9-6(5-7(15)17-3)8(13(16)18-4)10(19-9)12(11)21-14/h6,8-12H,5H2,1-4H3/t6-,8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | VMPXXGBYOUXCQP-SYIBODKJSA-N |
| XLogP | 0.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |