C14HF9O3 — CID 139210756
2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorobenzoyl)benzoic acid (PubChem CID 139210756) has the molecular formula C14HF9O3 and a molecular weight of 388.14 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorobenzoyl)benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorobenzoyl)benzoic acid |
|---|---|
| PubChem CID | 139210756 |
| Molecular Formula | C14HF9O3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorobenzoyl)benzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14HF9O3/c15-4-1(2(14(25)26)5(16)9(20)8(4)19)13(24)3-6(17)10(21)12(23)11(22)7(3)18/h(H,25,26) |
| InChIKey | WPJUXPLQEIXCJB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|