C15H3F9O4 — CID 139210770
2-[carboxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 139210770) has the molecular formula C15H3F9O4 and a molecular weight of 418.17 g/mol. Its IUPAC name is 2-[carboxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[carboxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 139210770 |
| Molecular Formula | C15H3F9O4 |
| Molecular Weight | 418.17 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | 2-[carboxy-(2,3,4,5,6-pentafluorophenyl)methyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(C(=O)O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H3F9O4/c16-5-1(4(15(27)28)8(19)12(23)9(5)20)2(14(25)26)3-6(17)10(21)13(24)11(22)7(3)18/h2H,(H,25,26)(H,27,28) |
| InChIKey | NEWSVRRGYBDVDX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|