C29H19N3O5S — CID 139210840
3-hydroxy-4-[4-[C-methyl-N-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]carbonimidoyl]phenyl]chromen-2-one (PubChem CID 139210840) has the molecular formula C29H19N3O5S and a molecular weight of 521.55 g/mol. Its IUPAC name is 3-hydroxy-4-[4-[C-methyl-N-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]carbonimidoyl]phenyl]chromen-2-one.
| Compound Name | 3-hydroxy-4-[4-[C-methyl-N-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]carbonimidoyl]phenyl]chromen-2-one |
|---|---|
| PubChem CID | 139210840 |
| Molecular Formula | C29H19N3O5S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 3-hydroxy-4-[4-[C-methyl-N-[[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]carbonimidoyl]phenyl]chromen-2-one |
| SMILES | CC(=NNc1nc(-c2cc3ccccc3oc2=O)cs1)c1ccc(-c2c(O)c(=O)oc3ccccc23)cc1 |
| InChI | InChI=1S/C29H19N3O5S/c1-16(17-10-12-18(13-11-17)25-20-7-3-5-9-24(20)37-28(35)26(25)33)31-32-29-30-22(15-38-29)21-14-19-6-2-4-8-23(19)36-27(21)34/h2-15,33H,1H3,(H,30,32) |
| InChIKey | TWTMCCUYQBLRCH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|