About 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine
4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine (PubChem CID 139211017) has the molecular formula C11H17ClN2
and a molecular weight of 212.72 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine |
| PubChem CID | 139211017 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine |
| SMILES | CC(CCc1ccnc(Cl)c1)N(C)C |
| InChI | InChI=1S/C11H17ClN2/c1-9(14(2)3)4-5-10-6-7-13-11(12)8-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | UJXWRLNJJBAKEY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine?
The IUPAC name of 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine (CID 139211017) is 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine.
What is the SMILES notation for 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine?
The canonical SMILES for 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine is CC(CCc1ccnc(Cl)c1)N(C)C.
What is the InChIKey of 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine?
The InChIKey is UJXWRLNJJBAKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2/c1-9(14(2)3)4-5-10-6-7-13-11(12)8-10/h6-9H,4-5H2,1-3H3.
What are the key properties of 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine?
4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine has a molecular weight of 212.72 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4-pyridinyl)-N,N-dimethylbutan-2-amine is sourced from PubChem (CID 139211017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).