C46H38N2O4 — CID 139211081
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1-tritylindol-3-yl)propanoic acid (PubChem CID 139211081) has the molecular formula C46H38N2O4 and a molecular weight of 682.82 g/mol. Its IUPAC name is 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1-tritylindol-3-yl)propanoic acid.
| Compound Name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1-tritylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 139211081 |
| Molecular Formula | C46H38N2O4 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1-tritylindol-3-yl)propanoic acid |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C46H38N2O4/c1-47(45(51)52-31-41-39-26-13-11-24-37(39)38-25-12-14-27-40(38)41)43(44(49)50)29-32-30-48(42-28-16-15-23-36(32)42)46(33-17-5-2-6-18-33,34-19-7-3-8-20-34)35-21-9-4-10-22-35/h2-28,30,41,43H,29,31H2,1H3,(H,49,50) |
| InChIKey | QNMQORQSNGSVRW-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|