About 2-(triazol-1-yl)ethyl sulfite
2-(triazol-1-yl)ethyl sulfite (PubChem CID 139211393) has the molecular formula C4H6N3O3S-
and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-(triazol-1-yl)ethyl sulfite.
Molecular Properties
| Compound Name | 2-(triazol-1-yl)ethyl sulfite |
| PubChem CID | 139211393 |
| Molecular Formula | C4H6N3O3S- |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 2-(triazol-1-yl)ethyl sulfite |
| SMILES | O=S([O-])OCCn1ccnn1 |
| InChI | InChI=1S/C4H7N3O3S/c8-11(9)10-4-3-7-2-1-5-6-7/h1-2H,3-4H2,(H,8,9)/p-1 |
| InChIKey | BDUUQGZXHAWPTE-UHFFFAOYSA-M |
| XLogP | -0.91 |
| TPSA | 80.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(triazol-1-yl)ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-1-yl)ethyl sulfite?
The IUPAC name of 2-(triazol-1-yl)ethyl sulfite (CID 139211393) is 2-(triazol-1-yl)ethyl sulfite.
What is the SMILES notation for 2-(triazol-1-yl)ethyl sulfite?
The canonical SMILES for 2-(triazol-1-yl)ethyl sulfite is O=S([O-])OCCn1ccnn1.
What is the InChIKey of 2-(triazol-1-yl)ethyl sulfite?
The InChIKey is BDUUQGZXHAWPTE-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7N3O3S/c8-11(9)10-4-3-7-2-1-5-6-7/h1-2H,3-4H2,(H,8,9)/p-1.
What are the key properties of 2-(triazol-1-yl)ethyl sulfite?
2-(triazol-1-yl)ethyl sulfite has a molecular weight of 176.18 g/mol, XLogP of -0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)ethyl sulfite is sourced from PubChem (CID 139211393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).