About CID 139211729
CID 139211729 (PubChem CID 139211729) has the molecular formula C11H17O4Se
and a molecular weight of 292.21 g/mol.
Molecular Properties
| Compound Name | CID 139211729 |
| PubChem CID | 139211729 |
| Molecular Formula | C11H17O4Se |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | — |
| SMILES | CCCCC1OC(=O)C(CC(=O)OC)C1[Se] |
| InChI | InChI=1S/C11H17O4Se/c1-3-4-5-8-10(16)7(11(13)15-8)6-9(12)14-2/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | FUEYEGMYWSFYIV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139211729 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139211729?
The IUPAC name of CID 139211729 (CID 139211729) is not available.
What is the SMILES notation for CID 139211729?
The canonical SMILES for CID 139211729 is CCCCC1OC(=O)C(CC(=O)OC)C1[Se].
What is the InChIKey of CID 139211729?
The InChIKey is FUEYEGMYWSFYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17O4Se/c1-3-4-5-8-10(16)7(11(13)15-8)6-9(12)14-2/h7-8,10H,3-6H2,1-2H3.
What are the key properties of CID 139211729?
CID 139211729 has a molecular weight of 292.21 g/mol, XLogP of 1.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139211729 is sourced from PubChem (CID 139211729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).