About CID 139211875
CID 139211875 (PubChem CID 139211875) has the molecular formula H3O7Si5
and a molecular weight of 255.45 g/mol.
Molecular Properties
| Compound Name | CID 139211875 |
| PubChem CID | 139211875 |
| Molecular Formula | H3O7Si5 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 254.87 |
| IUPAC Name | — |
| SMILES | O[Si](O[Si])O[Si](O)O[Si](O)O[Si] |
| InChI | InChI=1S/H3O7Si5/c1-10(4-8)6-12(3)7-11(2)5-9/h1-3H |
| InChIKey | SKSLNXCAEKSEPO-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139211875 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139211875?
The IUPAC name of CID 139211875 (CID 139211875) is not available.
What is the SMILES notation for CID 139211875?
The canonical SMILES for CID 139211875 is O[Si](O[Si])O[Si](O)O[Si](O)O[Si].
What is the InChIKey of CID 139211875?
The InChIKey is SKSLNXCAEKSEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O7Si5/c1-10(4-8)6-12(3)7-11(2)5-9/h1-3H.
What are the key properties of CID 139211875?
CID 139211875 has a molecular weight of 255.45 g/mol, XLogP of -3.85, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139211875 is sourced from PubChem (CID 139211875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).