C18H15N3S3 — CID 139212091
7-(7,7-diethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 139212091) has the molecular formula C18H15N3S3 and a molecular weight of 369.54 g/mol. Its IUPAC name is 7-(7,7-diethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 7-(7,7-diethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 139212091 |
| Molecular Formula | C18H15N3S3 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 7-(7,7-diethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | CCC1(CC)c2ccsc2-c2sc(-c3cncc4nsnc34)cc21 |
| InChI | InChI=1S/C18H15N3S3/c1-3-18(4-2)11-5-6-22-16(11)17-12(18)7-14(23-17)10-8-19-9-13-15(10)21-24-20-13/h5-9H,3-4H2,1-2H3 |
| InChIKey | BWSGMRJVDVBMTN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |