C26H29N3O6Si — CID 139212137
N-[(3R)-3-[3-[hydroxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide (PubChem CID 139212137) has the molecular formula C26H29N3O6Si and a molecular weight of 507.62 g/mol. Its IUPAC name is N-[(3R)-3-[3-[hydroxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(3R)-3-[3-[hydroxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 139212137 |
| Molecular Formula | C26H29N3O6Si |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | N-[(3R)-3-[3-[hydroxy(dimethyl)silyl]propyl]-1,2,3,4-tetrahydrophenanthren-4-yl]-3,5-dinitrobenzamide |
| SMILES | C[Si](C)(O)CCC[C@H]1CCc2ccc3ccccc3c2C1NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H29N3O6Si/c1-36(2,35)13-5-7-19-12-11-18-10-9-17-6-3-4-8-23(17)24(18)25(19)27-26(30)20-14-21(28(31)32)16-22(15-20)29(33)34/h3-4,6,8-10,14-16,19,25,35H,5,7,11-13H2,1-2H3,(H,27,30)/t19-,25?/m0/s1 |
| InChIKey | YWFZLCWVNIURNQ-UBDBMELISA-N |
| XLogP | 5.67 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|