C31H39N3O10 — CID 139212152
2-[[(2R,4S,5S,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 139212152) has the molecular formula C31H39N3O10 and a molecular weight of 613.66 g/mol. Its IUPAC name is 2-[[(2R,4S,5S,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(2R,4S,5S,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139212152 |
| Molecular Formula | C31H39N3O10 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 2-[[(2R,4S,5S,6R)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC[C@H]1C[C@H](OC(=O)Nc2cc(C)cc(C)c2)[C@H](OC(=O)Nc2cc(C)cc(C)c2)[C@H](O)O1 |
| InChI | InChI=1S/C31H39N3O10/c1-17(2)27(35)40-8-7-32-29(37)41-16-24-15-25(43-30(38)33-22-11-18(3)9-19(4)12-22)26(28(36)42-24)44-31(39)34-23-13-20(5)10-21(6)14-23/h9-14,24-26,28,36H,1,7-8,15-16H2,2-6H3,(H,32,37)(H,33,38)(H,34,39)/t24-,25+,26+,28-/m1/s1 |
| InChIKey | MCPKXSNVLGLFAG-ARXPIFDKSA-N |
| XLogP | 4.41 |
| TPSA | 170.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|