C28H16F2N6O8 — CID 139212866
2-(4-fluoro-3-nitrophenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 139212866) has the molecular formula C28H16F2N6O8 and a molecular weight of 602.47 g/mol. Its IUPAC name is 2-(4-fluoro-3-nitrophenyl)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-(4-fluoro-3-nitrophenyl)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 139212866 |
| Molecular Formula | C28H16F2N6O8 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | 2-(4-fluoro-3-nitrophenyl)-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3ccc(F)c([N+](=O)[O-])c3)[nH]c2c1.O=C(O)c1ccc2nc(-c3ccc(F)c([N+](=O)[O-])c3)[nH]c2c1 |
| InChI | InChI=1S/2C14H8FN3O4/c2*15-9-3-1-7(6-12(9)18(21)22)13-16-10-4-2-8(14(19)20)5-11(10)17-13/h2*1-6H,(H,16,17)(H,19,20) |
| InChIKey | RNIONLXGNFGBPG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 218.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|